| SpectraBase Spectrum ID |
42G39gbW6UG |
| Name |
Caroverine |
| CAS Registry Number |
23465-76-1 |
| Collision Energy |
20 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
365.210327119 u |
| Formula |
C22H27N3O2 |
| InChI |
InChI=1S/C22H27N3O2/c1-4-24(5-2)14-15-25-21-9-7-6-8-19(21)23-20(22(25)26)16-17-10-12-18(27-3)13-11-17/h6-13H,4-5,14-16H2,1-3H3 |
| InChIKey |
MSPRUJDUTKRMLM-UHFFFAOYSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
P |
| Ionization Type |
ESI+ |
| Molecular Weight |
365.477 g/mol |
| Nominal Mass |
365 u |
| Precursor Ion |
[M+H]+ |
| Precursor m/z |
366.218 |
| SMILES |
C1(=O)N(CCN(CC)CC)C=2C(N=C1CC1=CC=C(OC)C=C1)=CC=CC2 |
| Selected Ion Charge |
1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
1-[2-(diethylamino)ethyl]-3-[(4-methoxyphenyl)methyl]quinoxalin-2-one |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_+_171.3 |
![1-[2-(diethylamino)ethyl]-3-(p-methoxybenzyl)-2-(1H)-quinoxalinone](/api/spectrum/42G39gbW6UG/structure.png?h=300&w=458 "1-[2-(diethylamino)ethyl]-3-(p-methoxybenzyl)-2-(1H)-quinoxalinone")
