| SpectraBase Spectrum ID |
3wyevuFyrJU |
| Name |
7-Methoxy-2-tetralone |
| Source of Sample |
Alfa Aesar, Thermo Fisher Scientific |
| Catalog Number |
B22432 |
| Lot Number |
10158967 |
| Accessory |
TRANS *14560FA0 |
| Acquisition Mode |
double sided, forward-backward |
| Actual Signal Gain |
2 |
| Actual Signal Gain 2nd Channel |
1 |
| Additional Data Treatment |
0 |
| Analog Signal 1 |
0.270958 |
| Analog Signal 2 |
0 |
| Aperture Setting |
6 mm |
| Apodization Function |
Norton-Beer, medium |
| Background Measurement Channel |
Sample Compartment |
| Background Peak Amplitude 2nd Channel |
1 |
| Background Peak Location 2nd Channel |
1 |
| Background Scans |
32 |
| Background Scans or Time |
Scans |
| Backward Peak Amplitude |
-11024 |
| Backward Peak Location |
14480 |
| Beam Splitter Setting |
KBr |
| CAS Registry Number |
4133-34-0 |
| Container ID |
C-009942 |
| Copyright |
Copyright © 2018-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Data Point Format |
1 |
| Delay Before Measurement |
0 s |
| Detector Setting |
RT-DLaTGS [Internal] |
| End Frequency Limit for File |
340 |
| External Synchronization |
Off |
| Focal Length |
100 |
| Formula |
C11H12O2 |
| Frequency of First Point |
3999.74 cm⁻¹ |
| Frequency of Last Point |
339.942 cm⁻¹ |
| High Folding Limit |
15800.3 |
| High Frequency Limit |
8000 cm⁻¹ |
| High Pass Filter |
0 |
| InChI |
InChI=1S/C11H12O2/c1-13-11-5-3-8-2-4-10(12)6-9(8)7-11/h3,5,7H,2,4,6H2,1H3 |
| InChIKey |
XEAPZXNZOJGVCZ-UHFFFAOYSA-N |
| Instrument Name |
Bruker Tensor 27 FT-IR |
| Laser Wavenumber |
15800.3 cm⁻¹ |
| Low Folding Limit |
0 |
| Low Frequency Limit |
0 |
| Low Pass Filter |
10 |
| Non Linearity Correction |
0 |
| Number of Points |
15181 |
| Number of Sample Scans |
32 |
| Optical Filter Setting |
Open |
| Peak Amplitude |
-10955 |
| Peak Amplitude 2nd Channel |
1 |
| Peak Location |
14475 |
| Peak Location 2nd Channel |
1 |
| Phase Correction Mode |
Mertz |
| Phase Resolution |
4 |
| Physical State |
Liquid |
| Preamplifier Gain Background |
0 |
| Purity |
98% |
| Relative Humidity Interferometer |
20 % |
| Resolution |
2 |
| SKU |
B22432-1G |
| SMILES |
c12cc(ccc1CCC(C2)=O)OC |
| Sample Spacing Divisor |
1 |
| Sample Spacing Multiplicator |
1 |
| Scan Time |
50.037 s |
| Scanner Temperature |
33.4 °C |
| Scanner Velocity |
10 kHz |
| Signal Gain, Background |
automatic |
| Source of Spectrum |
Bio-Rad Laboratories, Inc. |
| Start Frequency Limit for File |
4000 cm⁻¹ |
| Synonyms |
7-Methoxy-3,4-dihydronaphthalen-2(1H)-one |
| Technique |
Neat |
| Window |
KBr Window - 1 Side |
| Zero Filling Factor |
8 |
