| SpectraBase Spectrum ID |
3aQ7X7NZ84r |
| Name |
Cinnamic acid, 3,4-dimethoxy-, trimethylsilyl ester |
| Alternate Name(s) |
(E)-3-(3,4-dimethoxyphenyl)-2-propenoic acid trimethylsilyl ester
(E)-3-(3,4-dimethoxyphenyl)acrylic acid trimethylsilyl ester
3,4-Dimethoxycinnamic acid trimethylsilyl derivative
Monotrimethylsilyl derivative of 3,4-dimethoxycinnamic acid
Trimethylsilyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
| CAS Registry Number |
27750-71-6 |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C14H20O4Si |
| InChI |
InChI=1S/C14H20O4Si/c1-16-12-8-6-11(10-13(12)17-2)7-9-14(15)18-19(3,4)5/h6-10H,1-5H3/b9-7+ |
| InChIKey |
XURFXZGYZJXCEH-VQHVLOKHSA-N |
| Molecular Weight |
280.395 g/mol |
| SMILES |
COc1c(OC)cc(\C=C\C(=O)O[Si](C)(C)C)cc1 |
| SPLASH |
splash10-00sl-5790000000-7f1fa8ae7d9b951d1990 |
| Source of Spectrum |
O-5-210-6 |
| Wiley ID |
40908 |
