| SpectraBase Spectrum ID |
3VLZ4Yf1r5Q |
| Name |
[3-(Dimethylamino)-4,6-dimethoxy-1H-indol-2-yl](phenyl)methanone |
| Appearance |
Orange solid |
| Copyright |
Copyright © 2020-2025 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C19H20N2O3 |
| InChI |
InChI=1S/C19H20N2O3/c1-21(2)18-16-14(10-13(23-3)11-15(16)24-4)20-17(18)19(22)12-8-6-5-7-9-12/h5-11,20H,1-4H3 |
| InChIKey |
BAKWZHVXHMIONN-UHFFFAOYSA-N |
| Instrument Name |
Thermo-Finnigan Polaris Q and Jeol JSM-GCMateII |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3998/ark.5550190.p008.138 |
| Molecular Weight |
324.380 g/mol |
| Reported Formula |
C19H20N2O3 |
| SMILES |
[nH]1c2c(c(c1C(=O)c1ccccc1)N(C)C)c(cc(c2)OC)OC |
| SPLASH |
splash10-0a4i-1129000000-21b0d57969a77e4918e5 |
| Source of Spectrum |
ARK-2014-47-2n |
| Thin-Layer Chromatography |
Rf = 0.49 (hexane/EtOAc, 7:3) |
| Wiley ID |
1843246 |
methanone](/api/spectrum/3VLZ4Yf1r5Q/structure.png?h=300&w=458 "[3-(Dimethylamino)-4,6-dimethoxy-1H-indol-2-yl](phenyl)methanone")
