| SpectraBase Spectrum ID |
3PdbOcTdYft |
| Name |
1-(3-Methylphenyl)ethanol |
| Source of Sample |
Alfa Aesar, Thermo Fisher Scientific |
| Catalog Number |
H32784 |
| Lot Number |
10161616 |
| Accessory |
DuraSample IR #145404C7 |
| Acquisition Mode |
double sided, forward-backward |
| Actual Signal Gain |
8 |
| Actual Signal Gain 2nd Channel |
1 |
| Additional Data Treatment |
1 |
| Analog Signal 1 |
0.270364 |
| Analog Signal 2 |
0 |
| Aperture Setting |
6 mm |
| Apodization Function |
Norton-Beer, medium |
| Background Measurement Channel |
Sample Compartment |
| Background Peak Amplitude 2nd Channel |
1 |
| Background Peak Location 2nd Channel |
1 |
| Background Rotations |
32 |
| Background Scans |
32 |
| Background Scans or Time |
Scans |
| Backward Peak Amplitude |
-1933 |
| Backward Peak Location |
7369 |
| Beam Splitter Setting |
KBr |
| CAS Registry Number |
25675-28-9 |
| Container ID |
C-009977 |
| Copyright |
Copyright © 2018-2025 John Wiley & Sons, Inc. All Rights Reserved. |
| Data Point Format |
1 |
| Delay Before Measurement |
1 s |
| Detector Setting |
RT-DLaTGS [Internal] |
| End Frequency Limit for File |
340 |
| External Synchronization |
Off |
| Focal Length |
100 |
| Formula |
C9H12O |
| Frequency of First Point |
3998.29 cm⁻¹ |
| Frequency of Last Point |
339.46 cm⁻¹ |
| High Folding Limit |
15800.3 |
| High Frequency Limit |
8000 cm⁻¹ |
| High Pass Filter |
0 |
| InChI |
InChI=1S/C9H12O/c1-7-4-3-5-9(6-7)8(2)10/h3-6,8,10H,1-2H3 |
| InChIKey |
SPNHUMWMKXWVIU-UHFFFAOYSA-N |
| Instrument Name |
Bruker Tensor 27 FT-IR |
| Laser Wavenumber |
15800.3 cm⁻¹ |
| Low Folding Limit |
0 |
| Low Frequency Limit |
0 |
| Low Pass Filter |
10 |
| Measurement Channel |
Sample Compartment |
| Non Linearity Correction |
0 |
| Number of Points |
3795 |
| Number of Sample Scans |
32 |
| Optical Filter Setting |
Open |
| Peak Amplitude |
-1962 |
| Peak Amplitude 2nd Channel |
1 |
| Peak Location |
7366 |
| Peak Location 2nd Channel |
1 |
| Phase Correction Mode |
Mertz |
| Phase Resolution |
8 |
| Preamplifier Gain |
3 |
| Preamplifier Gain Background |
0 |
| Purity |
97% |
| Relative Humidity Interferometer |
20 % |
| Resolution |
4 |
| SKU |
H32784-1G |
| SMILES |
OC(c1cc(ccc1)C)C |
| Sample Rotations |
32 |
| Sample Scans or Time |
Scans |
| Sample Spacing Divisor |
1 |
| Sample Spacing Multiplicator |
1 |
| Scan Time |
27.295 s |
| Scanner Temperature |
27.8 °C |
| Scanner Velocity |
10 kHz |
| Signal Gain, Background |
automatic |
| Signal Gain, Sample |
automatic |
| Source of Spectrum |
Bio-Rad Laboratories, Inc. |
| Start Frequency Limit for File |
4000 cm⁻¹ |
| Synonyms |
α,3-Dimethylbenzyl alcohol; 1-(m-Tolyl)ethanol |
| Technique |
ATR-Neat |
| Zero Filling Factor |
4 |