| SpectraBase Spectrum ID |
3Gt30SAAwEz |
| Name |
Etomidate |
| CAS Registry Number |
33125-97-2 |
| Collision Energy |
20 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
244.121177761 u |
| Formula |
C14H16N2O2 |
| InChI |
InChI=1S/C14H16N2O2/c1-3-18-14(17)13-9-15-10-16(13)11(2)12-7-5-4-6-8-12/h4-11H,3H2,1-2H3 |
| InChIKey |
NPUKDXXFDDZOKR-UHFFFAOYSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
P |
| Ionization Type |
ESI+ |
| Molecular Weight |
244.294 g/mol |
| Nominal Mass |
244 u |
| Precursor Ion |
[M+H]+ |
| Precursor m/z |
245.129 |
| SMILES |
C(OCC)(=O)C=1N(C(C2=CC=CC=C2)C)C=NC1 |
| Selected Ion Charge |
1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
ethyl 3-(1-phenylethyl)imidazole-4-carboxylate |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_+_351.3 |
