| SpectraBase Spectrum ID |
37jL6XW4G0 |
| Name |
1-[3-(Dimethylamino)-4,6-dimethoxy-1H-indol-2-yl]ethanone |
| Appearance |
Yellow solid |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C14H18N2O3 |
| InChI |
InChI=1S/C14H18N2O3/c1-8(17)13-14(16(2)3)12-10(15-13)6-9(18-4)7-11(12)19-5/h6-7,15H,1-5H3 |
| InChIKey |
STWODHGLHGAQRF-UHFFFAOYSA-N |
| Instrument Name |
Thermo-Finnigan Polaris Q and Jeol JSM-GCMateII |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3998/ark.5550190.p008.138 |
| Molecular Weight |
262.309 g/mol |
| Reported Formula |
C14H18N2O3 |
| SMILES |
[nH]1c2c(c(c1C(C)=O)N(C)C)c(cc(c2)OC)OC |
| SPLASH |
splash10-01ot-0290000000-8e71ae524c5684ee3f1f |
| Source of Spectrum |
ARK-2014-46-2j |
| Thin-Layer Chromatography |
Rf = 0.53 (hexane/EtOAc, 7:3) |
| Wiley ID |
1843242 |
![1-[3-(Dimethylamino)-4,6-dimethoxy-1H-indol-2-yl]ethanone](/api/spectrum/37jL6XW4G0/structure.png?h=300&w=458 "1-[3-(Dimethylamino)-4,6-dimethoxy-1H-indol-2-yl]ethanone")
