| SpectraBase Spectrum ID |
35V4qYMOxlc |
| Name |
Drotaverin |
| CAS Registry Number |
14009-24-6 |
| Collision Energy |
35 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
397.225308478 u |
| Formula |
C24H31NO4 |
| InChI |
InChI=1S/C24H31NO4/c1-5-26-21-10-9-17(14-22(21)27-6-2)13-20-19-16-24(29-8-4)23(28-7-3)15-18(19)11-12-25-20/h9-10,13-16,25H,5-8,11-12H2,1-4H3/b20-13- |
| InChIKey |
OMFNSKIUKYOYRG-MOSHPQCFSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
P |
| Ionization Type |
ESI+ |
| Molecular Weight |
397.515 g/mol |
| Nominal Mass |
397 u |
| Precursor Ion |
[M+H]+ |
| Precursor m/z |
398.233 |
| SMILES |
N1\C(C=2C(CC1)=CC(=C(C2)OCC)OCC)=C/C1=CC(OCC)=C(OCC)C=C1 |
| Selected Ion Charge |
1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
(1Z)-1-[(3,4-diethoxyphenyl)methylidene]-6,7-diethoxy-3,4-dihydro-2H-isoquinoline |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_+_320.6 |
