| SpectraBase Spectrum ID |
2rXDpSWOXn1 |
| Name |
2-[(3,5-Dimethoxyphenyl)amino]-1-(4-fluorophenyl)ethanone |
| Appearance |
Green oil |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C16H16FNO3 |
| InChI |
InChI=1S/C16H16FNO3/c1-20-14-7-13(8-15(9-14)21-2)18-10-16(19)11-3-5-12(17)6-4-11/h3-9,18H,10H2,1-2H3 |
| InChIKey |
ZLNGOLJDALKLEF-UHFFFAOYSA-N |
| Instrument Name |
Thermo-Finnigan Polaris Q and Jeol JSM-GCMateII |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3998/ark.5550190.p008.138 |
| Molecular Weight |
289.306 g/mol |
| Reported Formula |
C16H16FNO3 |
| SMILES |
N(c1cc(cc(OC)c1)OC)CC(=O)c1ccc(cc1)F |
| SPLASH |
splash10-01b9-2920000000-b661e539e063cf078909 |
| Source of Spectrum |
ARK-2014-34-4p |
| Thin-Layer Chromatography |
Rf = 0.60 (hexane/EtOAc, 7:3) |
| Wiley ID |
1843276 |
![2-[(3,5-Dimethoxyphenyl)amino]-1-(4-fluorophenyl)ethanone](/api/spectrum/2rXDpSWOXn1/structure.png?h=300&w=458 "2-[(3,5-Dimethoxyphenyl)amino]-1-(4-fluorophenyl)ethanone")
