| SpectraBase Spectrum ID |
2qINmbsIM4u |
| Name |
Cyclopentolate |
| CAS Registry Number |
512-15-2 |
| Collision Energy |
25 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
291.183443666 u |
| Formula |
C17H25NO3 |
| InChI |
InChI=1S/C17H25NO3/c1-18(2)12-13-21-16(19)15(14-8-4-3-5-9-14)17(20)10-6-7-11-17/h3-5,8-9,15,20H,6-7,10-13H2,1-2H3 |
| InChIKey |
SKYSRIRYMSLOIN-UHFFFAOYSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
P |
| Ionization Type |
ESI+ |
| Molecular Weight |
291.391 g/mol |
| Nominal Mass |
291 u |
| Precursor Ion |
[M+H]+ |
| Precursor m/z |
292.191 |
| SMILES |
OC1(CCCC1)C(C1=CC=CC=C1)C(OCCN(C)C)=O |
| Selected Ion Charge |
1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
2-(dimethylamino)ethyl 2-(1-hydroxycyclopentyl)-2-phenylacetate |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_+_257.4 |