| SpectraBase Spectrum ID |
2pAaHm78oaG |
| Name |
5-Androstenediol-3-acetate |
| CAS Registry Number |
1639-43-6 |
| Classification |
Pharmaceutical drug, androgen anabolic |
| Copyright |
Copyright © 2024 DigiLab GmbH and Wiley-VCH GmbH. All Rights Reserved. |
| DEA Citation |
21 CFR §1308.13 (f) (6) |
| DEA Controlled Substance Name |
5-androstenediol |
| DEA Controlled Substance Type |
Salts, esters and ethers |
| DEA Controlled Substances Code Number |
4000 |
| DEA Schedule |
Schedule III |
| DEA Section |
Anabolic Steroids. Unless specifically excepted or unless listed in another schedule, any material, compound, mixture or preparation containing any quantity of the following substances, including its salts, esters and ethers. |
| Exact Mass |
332.235144887 u |
| Formula |
C21H32O3 |
| InChI |
InChI=1S/C21H32O3/c1-13(22)24-15-8-10-20(2)14(12-15)4-5-16-17-6-7-19(23)21(17,3)11-9-18(16)20/h4,15-19,23H,5-12H2,1-3H3/t15-,16-,17-,18-,19-,20-,21-/m0/s1 |
| InChIKey |
OQHMNEGOKQMOFM-BPSSIEEOSA-N |
| Ionization Type |
Electron Ionization (EI) |
| Molecular Weight |
332.484 g/mol |
| Nominal Mass |
332 u |
| Quality |
974 |
| Retention Index |
2619 |
| SMILES |
O[C@@]1([C@@]2([C@]([C@]3([C@@]([C@@]4(C(=CC3)C[C@](CC4)(OC(=O)C)[H])C)(CC2)[H])[H])(CC1)[H])C)[H] |
| SPLASH |
splash10-006x-3930000000-c474c9bae3a785c9f3ac |
| Source of Spectrum |
DigiLab GmbH (C) 2024 |
| Synonyms |
5-Androsten-3beta,17beta-diol-3-acetate |
| Technique |
GC/MS |
| Wiley ID |
DD2024_014528 |
