| SpectraBase Spectrum ID |
2oQqfT5guf |
| Name |
Heptanoic acid, 2,2-dimethyl-6-oxo-, methyl ester |
| Alternate Name(s) |
Methyl 2,2-dimethyl-6-oxoheptanoate
2,2-Dimethyl-6-oxoheptanoic acid methyl ester
6-keto-2,2-dimethyl-enanthic acid methyl ester
Methyl 2,2-dimethyl-6-oxidanylidene-heptanoate
Methyl ester of 2,2-Dimethyl-6-oxoheptanoic acid |
| CAS Registry Number |
926-27-2 |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C10H18O3 |
| InChI |
InChI=1S/C10H18O3/c1-8(11)6-5-7-10(2,3)9(12)13-4/h5-7H2,1-4H3 |
| InChIKey |
WMAHWHYQGFDCIQ-UHFFFAOYSA-N |
| Molecular Weight |
186.251 g/mol |
| SMILES |
C(C(CCCC(=O)C)(C)C)(=O)OC |
| SPLASH |
splash10-0ktf-9600000000-c0d733695389bb50d92b |
| Source of Spectrum |
H-61-2695-0 |
| Wiley ID |
1182746 |
