| SpectraBase Spectrum ID |
2fAYeBRQan6 |
| Name |
(4SR)-(??)-1-Methyl-4-methylbutoxy-1,2,3,4-tetrahydroquinoline |
| Appearance |
Colorless liquid |
| Copyright |
Copyright © 2020-2025 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C15H23NO |
| InChI |
InChI=1S/C15H23NO/c1-3-4-11-17-12-13-9-10-16(2)15-8-6-5-7-14(13)15/h5-8,13H,3-4,9-12H2,1-2H3 |
| InChIKey |
GSSGGEHPJKRLRJ-UHFFFAOYSA-N |
| Instrument Name |
Varian MAT 311A and Varian MAT 731 |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3998/ark.5550190.0006.514 |
| Molecular Weight |
233.355 g/mol |
| SMILES |
CN1CCC(c2ccccc12)COCCCC |
| SPLASH |
splash10-0002-2910000000-22485afe9f3eea91b4bd |
| Source of Spectrum |
ARK-2005-166-45 |
| Thin-Layer Chromatography |
Rf = 0.25 (diethyl ether/petroleum ether, 1:15) |
| Wiley ID |
1871033 |
