| SpectraBase Spectrum ID |
2IwxuhOSEMq |
| Name |
Diphenylamine |
| CAS Registry Number |
122-39-4 |
| Collision Energy |
35 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
169.089149358 u |
| Formula |
C12H11N |
| InChI |
InChI=1S/C12H11N/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10,13H |
| InChIKey |
DMBHHRLKUKUOEG-UHFFFAOYSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
P |
| Ionization Type |
ESI+ |
| Molecular Weight |
169.227 g/mol |
| Nominal Mass |
169 u |
| Precursor Ion |
[M+H]+ |
| Precursor m/z |
170.096 |
| SMILES |
N(C1=CC=CC=C1)C1=CC=CC=C1 |
| Selected Ion Charge |
1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
N-phenylaniline |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_+_301.6 |
