| SpectraBase Spectrum ID |
1tCYAb6n5QJ |
| Name |
Methyl 2-(3-methoxyphenylamino)acetate |
| Appearance |
Brown oil |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C10H13NO3 |
| InChI |
InChI=1S/C10H13NO3/c1-13-9-5-3-4-8(6-9)11-7-10(12)14-2/h3-6,11H,7H2,1-2H3 |
| InChIKey |
KCMZCXBDVCGYMS-UHFFFAOYSA-N |
| Instrument Name |
Thermo-Finnigan Polaris Q and Jeol JSM-GCMateII |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3998/ark.5550190.p008.138 |
| Molecular Weight |
195.218 g/mol |
| Reported Formula |
C10H13NO3 |
| SMILES |
N(CC(OC)=O)c1cc(ccc1)OC |
| SPLASH |
splash10-0fc0-0900000000-ebcf2e54897acd16f631 |
| Source of Spectrum |
ARK-2014-31-4b |
| Thin-Layer Chromatography |
Rf = 0.51 (hexane/EtOAc, 7:3) |
| Wiley ID |
1843263 |
