| SpectraBase Spectrum ID |
1fJm5WnROrE |
| Name |
1-(6-Methoxy-1H-indol-2-yl)ethanone |
| Appearance |
White solid |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C11H11NO2 |
| InChI |
InChI=1S/C11H11NO2/c1-7(13)10-5-8-3-4-9(14-2)6-11(8)12-10/h3-6,12H,1-2H3 |
| InChIKey |
BKUMKXYVOCLMJO-UHFFFAOYSA-N |
| Instrument Name |
Thermo-Finnigan Polaris Q and Jeol JSM-GCMateII |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3998/ark.5550190.p008.138 |
| Molecular Weight |
189.214 g/mol |
| Reported Formula |
C11H11NO2 |
| SMILES |
[nH]1c(cc2c1cc(cc2)OC)C(C)=O |
| SPLASH |
splash10-052r-1900000000-2543129082873321e62c |
| Source of Spectrum |
ARK-2014-41-1i |
| Thin-Layer Chromatography |
Rf = 0.47 (hexane/EtOAc, 7:3) |
| Wiley ID |
1843227 |
