| SpectraBase Spectrum ID |
1W8TUeJdfwc |
| Name |
Dibucaine |
| CAS Registry Number |
85-79-0 |
| Collision Energy |
30 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
343.225977184 u |
| Formula |
C20H29N3O2 |
| InChI |
InChI=1S/C20H29N3O2/c1-4-7-14-25-19-15-17(16-10-8-9-11-18(16)22-19)20(24)21-12-13-23(5-2)6-3/h8-11,15H,4-7,12-14H2,1-3H3,(H,21,24) |
| InChIKey |
PUFQVTATUTYEAL-UHFFFAOYSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
P |
| Ionization Type |
ESI+ |
| Molecular Weight |
343.471 g/mol |
| Nominal Mass |
343 u |
| Precursor Ion |
[M+H]+ |
| Precursor m/z |
344.233 |
| SMILES |
N(CCN(CC)CC)C(=O)C=1C=2C(N=C(OCCCC)C1)=CC=CC2 |
| Selected Ion Charge |
1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
2-butoxy-N-[2-(diethylamino)ethyl]quinoline-4-carboxamide |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_+_214.5 |