| SpectraBase Spectrum ID |
19FZX4PNGi |
| Name |
Dromostanolone acetate |
| CAS Registry Number |
1923-17-7 |
| Classification |
Pharmaceutical drug, anabolic |
| Copyright |
Copyright © 2024 DigiLab GmbH and Wiley-VCH GmbH. All Rights Reserved. |
| DEA Citation |
21 CFR §1308.13 (f) (28) |
| DEA Controlled Substance Name |
drostanolone |
| DEA Controlled Substance Type |
Salts, esters and ethers |
| DEA Controlled Substances Code Number |
4000 |
| DEA Schedule |
Schedule III |
| DEA Section |
Anabolic Steroids. Unless specifically excepted or unless listed in another schedule, any material, compound, mixture or preparation containing any quantity of the following substances, including its salts, esters and ethers. |
| Exact Mass |
346.250794952 u |
| Formula |
C22H34O3 |
| InChI |
InChI=1S/C22H34O3/c1-13-12-22(4)15(11-19(13)24)5-6-16-17-7-8-20(25-14(2)23)21(17,3)10-9-18(16)22/h13,15-18,20H,5-12H2,1-4H3/t13-,15?,16+,17+,18+,20+,21+,22+/m1/s1 |
| InChIKey |
KYSIZRLLLZQVFF-LWLPCEHWSA-N |
| Ionization Type |
Electron Ionization (EI) |
| Molecular Weight |
346.511 g/mol |
| Nominal Mass |
346 u |
| Quality |
920 |
| Retention Index |
2719 |
| SMILES |
[C@]12([C@@]([C@@]3(C(CC2)CC([C@@](C3)(C)[H])=O)C)(CC[C@]2([C@]1(CC[C@@]2(OC(=O)C)[H])[H])C)[H])[H] |
| SPLASH |
splash10-0072-3960000000-42ac8f861f0178b6a595 |
| Source of Spectrum |
DigiLab GmbH (C) 2024 |
| Synonyms |
17beta-Hydroxy-2alpha-methyl-5alpha-androstan-3-one acetate |
| Technique |
GC/MS |
| Wiley ID |
DD2024_014958 |
