Wiley SpectraBase; SpectraBase Compound ID=wjXk176XA
http://spectrabase.com/compound/wjXk176XA (accessed Sep 28, 2020).

SpectraBase Compound ID wjXk176XA
InChI InChI=1S/C10H19N/c1-9-5-6-10-4-2-3-7-11(10)8-9/h9-10H,2-8H2,1H3/t9-,10+/m0/s1
Mol Weight 153.27 g/mol
Molecular Formula C10H19N
Exact Mass 153.15175 g/mol