Wiley SpectraBase; SpectraBase Compound ID=tVq0suVb1
http://spectrabase.com/compound/tVq0suVb1 (accessed Sep 27, 2020).

SpectraBase Compound ID tVq0suVb1
InChI InChI=1S/C13H15N4.BF4/c1-16-8-9-17(10-16)7-6-13-14-11-4-2-3-5-12(11)15-13;2-1(3,4)5/h2-5,8-10H,6-7H2,1H3,(H,14,15);/q+1;-1
Mol Weight 314.09 g/mol
Molecular Formula C13H15BF4N4
Exact Mass 314.13259 g/mol