Wiley SpectraBase; SpectraBase Compound ID=tUrfD59Og
http://spectrabase.com/compound/tUrfD59Og (accessed Sep 25, 2020).

SpectraBase Compound ID tUrfD59Og
InChI InChI=1S/C7H5BrClN3/c8-6-1-2-7(9)5(3-6)4-11-12-10/h1-3H,4H2
Mol Weight 246.49 g/mol
Molecular Formula C7H5BrClN3
Exact Mass 244.935536 g/mol