Wiley SpectraBase; SpectraBase Compound ID=tH3uAUAL38
http://spectrabase.com/compound/tH3uAUAL38 (accessed Jul 11, 2020).

CIS-3-BENZOYLOXYCYCLOHEXANECARBONITRILE
SpectraBase Compound ID tH3uAUAL38
InChI InChI=1S/C14H15NO2/c15-10-11-5-4-8-13(9-11)17-14(16)12-6-2-1-3-7-12/h1-3,6-7,11,13H,4-5,8-9H2/t11-,13+/m1/s1
InChIKey JWRHHAATMUHQFK-YPMHNXCESA-N
Mol Weight 229.28 g/mol
Molecular Formula C14H15NO2
Exact Mass 229.110279 g/mol
Enantiomer InChIKey JWRHHAATMUHQFK-WCQYABFASA-N