Wiley SpectraBase; SpectraBase Compound ID=mdiQdwpJ70
http://spectrabase.com/compound/mdiQdwpJ70 (accessed Jul 11, 2020).

TRANS-4-BENZOYLOXYCYCLOHEXANEAMIDE
SpectraBase Compound ID mdiQdwpJ70
InChI InChI=1S/C14H17NO3/c15-13(16)10-6-8-12(9-7-10)18-14(17)11-4-2-1-3-5-11/h1-5,10,12H,6-9H2,(H2,15,16)/t10-,12-
InChIKey HPOPEKLVJFPJOJ-UMSPYCQHSA-N
Mol Weight 247.29 g/mol
Molecular Formula C14H17NO3
Exact Mass 247.120844 g/mol