Wiley SpectraBase; SpectraBase Compound ID=kzE0x1CkPh
http://spectrabase.com/compound/kzE0x1CkPh (accessed Sep 27, 2020).

SpectraBase Compound ID kzE0x1CkPh
InChI InChI=1S/C7H16N2/c1-9(2)7-3-5-8-6-4-7/h7-8H,3-6H2,1-2H3
Mol Weight 128.22 g/mol
Molecular Formula C7H16N2
Exact Mass 128.131349 g/mol