Wiley SpectraBase; SpectraBase Compound ID=eojBJ80LAN
http://spectrabase.com/compound/eojBJ80LAN (accessed Aug 04, 2020).

SpectraBase Compound ID eojBJ80LAN
InChI InChI=1S/C9H13N3/c1-4-8-7(6-10)9(5-2)12(3)11-8/h4-5H2,1-3H3
Mol Weight 163.22 g/mol
Molecular Formula C9H13N3
Exact Mass 163.110948 g/mol