Wiley SpectraBase; SpectraBase Compound ID=eoVPSxg5RJ
http://spectrabase.com/compound/eoVPSxg5RJ (accessed Aug 04, 2020).

SpectraBase Compound ID eoVPSxg5RJ
InChI InChI=1S/C9H12O8/c1-9(2)15-3-4(17-9)5(6(10)11)16-8(14)7(12)13/h4-5H,3H2,1-2H3,(H,10,11)(H,12,13)
Mol Weight 248.19 g/mol
Molecular Formula C9H12O8
Exact Mass 248.053218 g/mol