Wiley SpectraBase; SpectraBase Compound ID=eoEvnvtjI2
http://spectrabase.com/compound/eoEvnvtjI2 (accessed Aug 04, 2020).

1-METHYL5-AMINOINDAZOLE
SpectraBase Compound ID eoEvnvtjI2
InChI InChI=1S/C8H9N3/c1-11-8-3-2-7(9)4-6(8)5-10-11/h2-5H,9H2,1H3
InChIKey PYOFNPHTKBSXOM-UHFFFAOYSA-N
Mol Weight 147.18 g/mol
Molecular Formula C8H9N3
Exact Mass 147.079647 g/mol