Wiley SpectraBase; SpectraBase Compound ID=eoEhXX3BQ6
http://spectrabase.com/compound/eoEhXX3BQ6 (accessed Aug 04, 2020).

SpectraBase Compound ID eoEhXX3BQ6
InChI InChI=1S/C11H16O2/c1-13-7-3-6-10-8-4-2-5-9(8)11(10)12/h2,4,8-10H,3,5-7H2,1H3/t8-,9+,10-/m1/s1
Mol Weight 180.25 g/mol
Molecular Formula C11H16O2
Exact Mass 180.11503 g/mol