Wiley SpectraBase; SpectraBase Compound ID=en12VnZ1F4
http://spectrabase.com/compound/en12VnZ1F4 (accessed Aug 04, 2020).

SpectraBase Compound ID en12VnZ1F4
InChI InChI=1S/C6H11NOS/c1-6(2)4-7-5(8-3)9-6/h4H2,1-3H3
Mol Weight 145.22 g/mol
Molecular Formula C6H11NOS
Exact Mass 145.056136 g/mol