Wiley SpectraBase; SpectraBase Compound ID=ekFZtr6CCK
http://spectrabase.com/compound/ekFZtr6CCK (accessed Jul 14, 2020).

SpectraBase Compound ID ekFZtr6CCK
InChI InChI=1S/C11H11NO/c1-9(2)8-13-11-6-4-3-5-10(11)7-12/h3-6H,1,8H2,2H3
Mol Weight 173.21 g/mol
Molecular Formula C11H11NO
Exact Mass 173.084064 g/mol