Wiley SpectraBase; SpectraBase Compound ID=ejZhxUQCWf
http://spectrabase.com/compound/ejZhxUQCWf (accessed Aug 04, 2020).

SpectraBase Compound ID ejZhxUQCWf
InChI InChI=1S/C14H9NOS/c16-13-8-9-4-3-7-12-14(9)15(13)10-5-1-2-6-11(10)17-12/h1-7H,8H2
Mol Weight 239.29 g/mol
Molecular Formula C14H9NOS
Exact Mass 239.040486 g/mol