Wiley SpectraBase; SpectraBase Compound ID=egu7fw4Eed
http://spectrabase.com/compound/egu7fw4Eed (accessed Aug 03, 2020).

SpectraBase Compound ID egu7fw4Eed
InChI InChI=1S/C7H11N/c1-3-7-5-8-4-6(7)2/h4-5,8H,3H2,1-2H3
Mol Weight 109.17 g/mol
Molecular Formula C7H11N
Exact Mass 109.089149 g/mol