Wiley SpectraBase; SpectraBase Compound ID=efjVoE565J
http://spectrabase.com/compound/efjVoE565J (accessed Jul 12, 2020).

SpectraBase Compound ID efjVoE565J
InChI InChI=1S/C14H20O.FHO3S/c1-11-5-3-4-6-14(11)12-7-9-13(15-2)10-8-12;1-5(2,3)4/h7-11,14H,3-6H2,1-2H3;(H,2,3,4)/p-1
Mol Weight 303.37 g/mol
Molecular Formula C14H20FO4S
Exact Mass 303.106634 g/mol