Wiley SpectraBase; SpectraBase Compound ID=ecWLo2NGmX
http://spectrabase.com/compound/ecWLo2NGmX (accessed Jul 14, 2020).

SpectraBase Compound ID ecWLo2NGmX
InChI InChI=1S/C17H15N3O2/c1-10-8-13(12-6-4-3-5-7-12)18-16-15(10)17(22)20-14(19-16)9-11(2)21/h3-8H,9H2,1-2H3,(H,18,19,20,22)
Mol Weight 293.33 g/mol
Molecular Formula C17H15N3O2
Exact Mass 293.116427 g/mol