Wiley SpectraBase; SpectraBase Compound ID=ecJmOjWyT0
http://spectrabase.com/compound/ecJmOjWyT0 (accessed Aug 04, 2020).

7-(2,3-THIOEPOXYPROPYL)-THEOPHYLLINE
SpectraBase Compound ID ecJmOjWyT0
InChI InChI=1S/C10H12N4O2S/c1-12-8-7(9(15)13(2)10(12)16)14(5-11-8)3-6-4-17-6/h5-6H,3-4H2,1-2H3
InChIKey NSFASVBLNPALON-UHFFFAOYSA-N
Mol Weight 252.29 g/mol
Molecular Formula C10H12N4O2S
Exact Mass 252.068098 g/mol