Wiley SpectraBase; SpectraBase Compound ID=eb5RkA1KT0
http://spectrabase.com/compound/eb5RkA1KT0 (accessed Aug 04, 2020).

1-(2-chloroethynyl)-4-methylbenzene
SpectraBase Compound ID eb5RkA1KT0
InChI InChI=1S/C9H7Cl/c1-8-2-4-9(5-3-8)6-7-10/h2-5H,1H3
InChIKey DMZVMQDKSSBTNI-UHFFFAOYSA-N
Mol Weight 150.61 g/mol
Molecular Formula C9H7Cl
Exact Mass 150.023628 g/mol