Wiley SpectraBase; SpectraBase Compound ID=eb46BYOP4I
http://spectrabase.com/compound/eb46BYOP4I (accessed Aug 04, 2020).

SpectraBase Compound ID eb46BYOP4I
InChI InChI=1S/C13H9NO3/c1-17-13(16)9-7-11-12(15)6-5-8-3-2-4-10(9)14(8)11/h2-7H,1H3
Mol Weight 227.22 g/mol
Molecular Formula C13H9NO3
Exact Mass 227.058243 g/mol