Wiley SpectraBase; SpectraBase Compound ID=eYSCg8kYuo
http://spectrabase.com/compound/eYSCg8kYuo (accessed Aug 08, 2020).

SpectraBase Compound ID eYSCg8kYuo
InChI InChI=1S/C15H19NO5/c1-10-13(21-15(18)20-10)9-12(16(2)14(17)19-3)11-7-5-4-6-8-11/h4-8,10,12-13H,9H2,1-3H3/t10-,12-,13-/m1/s1
Mol Weight 293.32 g/mol
Molecular Formula C15H19NO5
Exact Mass 293.126323 g/mol