Wiley SpectraBase; SpectraBase Compound ID=eYOmxtY5uJ
http://spectrabase.com/compound/eYOmxtY5uJ (accessed Aug 04, 2020).

SpectraBase Compound ID eYOmxtY5uJ
InChI InChI=1S/C16H8O3/c17-14-12-7-8-19-16(12)11-6-5-9-3-1-2-4-10(9)13(11)15(14)18/h1-8H
Mol Weight 248.24 g/mol
Molecular Formula C16H8O3
Exact Mass 248.047344 g/mol