Wiley SpectraBase; SpectraBase Compound ID=eUhd9QxZZ9
http://spectrabase.com/compound/eUhd9QxZZ9 (accessed Aug 04, 2020).

SpectraBase Compound ID eUhd9QxZZ9
InChI InChI=1S/C13H12O3/c1-7-3-9-5-10(14)6-12-13(9)11(15-7)4-8(2)16-12/h4-7H,3H2,1-2H3
Mol Weight 216.24 g/mol
Molecular Formula C13H12O3
Exact Mass 216.078644 g/mol