Wiley SpectraBase; SpectraBase Compound ID=eNud7npTIX
http://spectrabase.com/compound/eNud7npTIX (accessed Aug 04, 2020).

SpectraBase Compound ID eNud7npTIX
InChI InChI=1S/C11H10O2/c1-2-11(13)9-6-4-3-5-8(9)7-10(11)12/h2-6,13H,1,7H2
Mol Weight 174.2 g/mol
Molecular Formula C11H10O2
Exact Mass 174.06808 g/mol