Wiley SpectraBase; SpectraBase Compound ID=eJxVDCgxuh
http://spectrabase.com/compound/eJxVDCgxuh (accessed Aug 04, 2020).

(2R,3R)-2-bromo-3-hydroxy-3-phenyl-propionic acid methyl ester
SpectraBase Compound ID eJxVDCgxuh
InChI InChI=1S/C10H11BrO3/c1-14-10(13)8(11)9(12)7-5-3-2-4-6-7/h2-6,8-9,12H,1H3/t8-,9-/m1/s1
Mol Weight 259.1 g/mol
Molecular Formula C10H11BrO3
Exact Mass 257.989155 g/mol