Wiley SpectraBase; SpectraBase Compound ID=eIxpc2WxeV
http://spectrabase.com/compound/eIxpc2WxeV (accessed Aug 04, 2020).

SpectraBase Compound ID eIxpc2WxeV
InChI InChI=1S/C20H28O4/c1-3-19(23)14-11-12-16-20(24-18(2)22)15-10-8-6-4-5-7-9-13-17-21/h3,10,15,19-21,23H,1,4-9,13,17H2,2H3/b15-10-/t19-,20-/m0/s1
Mol Weight 332.44 g/mol
Molecular Formula C20H28O4
Exact Mass 332.19876 g/mol