Wiley SpectraBase; SpectraBase Compound ID=eGt8GbXI7o
http://spectrabase.com/compound/eGt8GbXI7o (accessed Aug 03, 2020).

SpectraBase Compound ID eGt8GbXI7o
InChI InChI=1S/C7H13O3P/c1-8-11-9-5-6-3-2-4-7(6)10-11/h6-7H,2-5H2,1H3
Mol Weight 176.15 g/mol
Molecular Formula C7H13O3P
Exact Mass 176.060233 g/mol