Wiley SpectraBase; SpectraBase Compound ID=eEJ8v6Y7Mc
http://spectrabase.com/compound/eEJ8v6Y7Mc (accessed Aug 03, 2020).

SpectraBase Compound ID eEJ8v6Y7Mc
InChI InChI=1S/C13H19ClN4S/c14-11-6-4-5-10(11)9-15-17-12-16-13(18-19-12)7-2-1-3-8-13/h9,18H,1-8H2,(H,16,17)/b15-9+
Mol Weight 298.84 g/mol
Molecular Formula C13H19ClN4S
Exact Mass 298.101896 g/mol