Wiley SpectraBase; SpectraBase Compound ID=eDvo3Fvhdc
http://spectrabase.com/compound/eDvo3Fvhdc (accessed Aug 04, 2020).

SpectraBase Compound ID eDvo3Fvhdc
InChI InChI=1S/C8F11P/c9-1(3(11)12)2(10)6(17)20(7(18)4(13)14)8(19)5(15)16/b6-2-
Mol Weight 336.04 g/mol
Molecular Formula C8F11P
Exact Mass 335.956199 g/mol