Wiley SpectraBase; SpectraBase Compound ID=eCAH7jcvMd
http://spectrabase.com/compound/eCAH7jcvMd (accessed Aug 04, 2020).

SpectraBase Compound ID eCAH7jcvMd
InChI InChI=1S/C7H10O3/c1-5(8)10-7-4-2-3-6(7)9/h7H,2-4H2,1H3
Mol Weight 142.15 g/mol
Molecular Formula C7H10O3
Exact Mass 142.062994 g/mol