Wiley SpectraBase; SpectraBase Compound ID=b4xkqQIsC
http://spectrabase.com/compound/b4xkqQIsC (accessed Sep 20, 2020).

SpectraBase Compound ID b4xkqQIsC
InChI InChI=1S/C10H11N3O2/c1-6-4-11-10-12-8(15-3)7(2)5-13(10)9(6)14/h4-5H,1-3H3
Mol Weight 205.22 g/mol
Molecular Formula C10H11N3O2
Exact Mass 205.085127 g/mol