Wiley SpectraBase; SpectraBase Compound ID=aSTfzE7cW
http://spectrabase.com/compound/aSTfzE7cW (accessed Sep 20, 2020).

SpectraBase Compound ID aSTfzE7cW
InChI InChI=1S/C9H12O3/c1-11-8-4-2-3-5-9(8)12-7-6-10/h2-5,10H,6-7H2,1H3
Mol Weight 168.19 g/mol
Molecular Formula C9H12O3
Exact Mass 168.078644 g/mol