Wiley SpectraBase; SpectraBase Compound ID=a5jRaIt7v
http://spectrabase.com/compound/a5jRaIt7v (accessed Sep 23, 2020).

SpectraBase Compound ID a5jRaIt7v
InChI InChI=1S/C16H14O4/c1-12(17)5-3-2-4-10-19-14-8-6-13-7-9-16(18)20-15(13)11-14/h2-9,11H,10H2,1H3/b4-2+,5-3+
Mol Weight 270.28 g/mol
Molecular Formula C16H14O4
Exact Mass 270.089209 g/mol